beautiful chords and lyrics - JOYDROP

Lời & hợp âm

[Verse 1]
[Am]If I was beautiful like you,
oh [C]the things I would do
Those not so [Dm]blessed would be crying out
murder and I'd just laugh and get away
[E]With it too. like you do.

[Verse 2]
If I was [Am]beautiful like you,
I would [C]never be at fault
[G]I'd [Dm]walk in the rain between the raindrops,
bringing [E]traffic to a hault.

[Verse 3]
But [Am]that will never [G]be, that [C]will never ever
[D]be. 'cause [Em]I'm not b[F]eautiful like [E]you.
I'm beautiful [Am]like[B]
[F]me.[E]
[Am][E][B][F]

[Verse 4]
[E]
If I was [Am]beautiful like you,
I'd be [C]quick to assume. [G]they'd do [Dm]anything to
Please me why not. I see their reaction when you
[E]walk into [Am]the room.[G][C][D]
[E]CHORUS

[Interlude 1]
[F][E][Am][E][B][F][E][Am][E][B]
[F][E][Am][F#m][F][E][Dm]
[G][E][Am]

[Verse 5]
If I was beautiful [Am]like you,
I'd [C]have so many friends all fight[G]ing for [Dm]my time
To be next in line. so if I hurt one,
I wouldn't [E]have to make [Am]amends.[G][C][D]

[Outro 1]
CHORUS
[F][G][F][G][Em][E][F][E][Am][E][B][F][E]
[B][F][E][B][F][E][B][F][E][B][F]
[E][F][E][C][Am]