Hợp âm When You're Smiling

Lời & hợp âm

[Verse 1]
When [D]you're smilin',
when you're smilin', [A]baby
[Bm]The [D]whol[E]e world
[D]gonna smile w[A]ith y[D]ou[E]
[D]When [Bm]you're [Em]smil[G]in',
when [Bm]you're smilin'
The [B]whole [E]world smiles with [Abaug]you
[C]When [E]you're lau[Am]ghing,
oh, you're [D]laughing,
the [C]sun comes shin[Cdim]ing through[C]
[G]But [C]when you're [Dm]crying,
[Em]you bring [C]on the rain
So [Em]stop [G]that [A]sighing, baby,
be [C]happy again, [D]keep on [G]smiling
[C]Cau[G]se whe[Fdim]n you're smiling, bab[F]y,
[E]the who[A]le world's gon[D]na smile with you[G][Ab][A]

[Interlude 1]
[E][F#][Bm]
[C#m]
[Bm][A][C#][E][A][Bm][Em]
[A][D][A][B][Bm][E][A]
[F#][Bm][D]
[E]When

[Verse 2]
you're [A]smiling,
when you're smiling
The [F#m]whole [C#m]world [F#]smiles with [Bm]you
When you're [F#]laughing,
oh, [Bm]you're laughing
[D]The sun [E]comes shining through
[A]But when you're crying,
[Em]mama [A]babe, mama babe
You bring on the rain, so
[F#m]stop that sighing
Baby, [Bm]baby, baby, [D]bab[Bm]y,
you can keep [E]on [A]smilin'
Cause when you're [E]smil[F#]in', [A]baby,
[Bm]he alway[D]s wants me[E][Bb][Dm]
[Cm][C][Bb][Eb][Bb]
[C][Eb][Bb][Eb][Bb][Eb][C]
[Bbdim][Eb][C#dim]
[C]But [Bb]when you're [Fm]crying,
you bring [Bb]on t[Eb]he rain
So [C]stop that sighing, be happy again
Keep [Bm]on smiling,
[Bb]cause when you're smiling[Abdim]
[G]The whole [C]world [Eb]is gonna smile[Cm]
[Eb]I'm [Cm]with [D]you[Gb]

[Outro 1]
[Gb][Bb]